C8H5F7N2O — CID 91704498
2,2,3,3,4,4,4-heptafluoro-1-(4-methylpyrazol-1-yl)butan-1-one (PubChem CID 91704498) has the molecular formula C8H5F7N2O and a molecular weight of 278.13 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-(4-methylpyrazol-1-yl)butan-1-one.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-(4-methylpyrazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 91704498 |
| Molecular Formula | C8H5F7N2O |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-(4-methylpyrazol-1-yl)butan-1-one |
| SMILES | Cc1cnn(C(=O)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C8H5F7N2O/c1-4-2-16-17(3-4)5(18)6(9,10)7(11,12)8(13,14)15/h2-3H,1H3 |
| InChIKey | VMFUBLBXLBNKHY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|