About (3-hydroxyphenyl) 3-cyclopentylpropanoate
(3-hydroxyphenyl) 3-cyclopentylpropanoate (PubChem CID 91704521) has the molecular formula C14H18O3
and a molecular weight of 234.30 g/mol. Its IUPAC name is (3-hydroxyphenyl) 3-cyclopentylpropanoate.
Molecular Properties
| Compound Name | (3-hydroxyphenyl) 3-cyclopentylpropanoate |
| PubChem CID | 91704521 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (3-hydroxyphenyl) 3-cyclopentylpropanoate |
| SMILES | O=C(CCC1CCCC1)Oc1cccc(O)c1 |
| InChI | InChI=1S/C14H18O3/c15-12-6-3-7-13(10-12)17-14(16)9-8-11-4-1-2-5-11/h3,6-7,10-11,15H,1-2,4-5,8-9H2 |
| InChIKey | ATTJCMMVJOBMAD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxyphenyl) 3-cyclopentylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxyphenyl) 3-cyclopentylpropanoate?
The IUPAC name of (3-hydroxyphenyl) 3-cyclopentylpropanoate (CID 91704521) is (3-hydroxyphenyl) 3-cyclopentylpropanoate.
What is the SMILES notation for (3-hydroxyphenyl) 3-cyclopentylpropanoate?
The canonical SMILES for (3-hydroxyphenyl) 3-cyclopentylpropanoate is O=C(CCC1CCCC1)Oc1cccc(O)c1.
What is the InChIKey of (3-hydroxyphenyl) 3-cyclopentylpropanoate?
The InChIKey is ATTJCMMVJOBMAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c15-12-6-3-7-13(10-12)17-14(16)9-8-11-4-1-2-5-11/h3,6-7,10-11,15H,1-2,4-5,8-9H2.
What are the key properties of (3-hydroxyphenyl) 3-cyclopentylpropanoate?
(3-hydroxyphenyl) 3-cyclopentylpropanoate has a molecular weight of 234.30 g/mol, XLogP of 3.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxyphenyl) 3-cyclopentylpropanoate is sourced from PubChem (CID 91704521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).