C16H24F4O4 — CID 91704563
5-O-(3,4-dimethylcyclohexyl) 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate (PubChem CID 91704563) has the molecular formula C16H24F4O4 and a molecular weight of 356.36 g/mol. Its IUPAC name is 5-O-(3,4-dimethylcyclohexyl) 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate.
| Compound Name | 5-O-(3,4-dimethylcyclohexyl) 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
|---|---|
| PubChem CID | 91704563 |
| Molecular Formula | C16H24F4O4 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 5-O-(3,4-dimethylcyclohexyl) 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
| SMILES | CC1CCC(OC(=O)CCCC(=O)OCC(F)(F)C(F)F)CC1C |
| InChI | InChI=1S/C16H24F4O4/c1-10-6-7-12(8-11(10)2)24-14(22)5-3-4-13(21)23-9-16(19,20)15(17)18/h10-12,15H,3-9H2,1-2H3 |
| InChIKey | INGDEJDCLILKCP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|