C6H8F6O2 — CID 91705047
1,1,1,4,4,4-hexafluoro-2,3-dimethoxybutane (PubChem CID 91705047) has the molecular formula C6H8F6O2 and a molecular weight of 226.12 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluoro-2,3-dimethoxybutane.
| Compound Name | 1,1,1,4,4,4-hexafluoro-2,3-dimethoxybutane |
|---|---|
| PubChem CID | 91705047 |
| Molecular Formula | C6H8F6O2 |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 1,1,1,4,4,4-hexafluoro-2,3-dimethoxybutane |
| SMILES | COC(C(OC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H8F6O2/c1-13-3(5(7,8)9)4(14-2)6(10,11)12/h3-4H,1-2H3 |
| InChIKey | WNWDLIOBXHXLOX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |