C24H37NO — CID 91705061
(5Z,8Z,11Z,14Z,17Z)-1-pyrrolidin-1-ylicosa-5,8,11,14,17-pentaen-1-one (PubChem CID 91705061) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-1-pyrrolidin-1-ylicosa-5,8,11,14,17-pentaen-1-one.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-1-pyrrolidin-1-ylicosa-5,8,11,14,17-pentaen-1-one |
|---|---|
| PubChem CID | 91705061 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-1-pyrrolidin-1-ylicosa-5,8,11,14,17-pentaen-1-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C24H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-24(26)25-22-19-20-23-25/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-23H2,1H3/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | BQBRHERXDMIRCX-JLNKQSITSA-N |
| XLogP | 6.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|