C26H39NO — CID 91705072
(4Z,7Z,10Z,13Z,16Z,19Z)-1-pyrrolidin-1-yldocosa-4,7,10,13,16,19-hexaen-1-one (PubChem CID 91705072) has the molecular formula C26H39NO and a molecular weight of 381.60 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-1-pyrrolidin-1-yldocosa-4,7,10,13,16,19-hexaen-1-one.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-1-pyrrolidin-1-yldocosa-4,7,10,13,16,19-hexaen-1-one |
|---|---|
| PubChem CID | 91705072 |
| Molecular Formula | C26H39NO |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-1-pyrrolidin-1-yldocosa-4,7,10,13,16,19-hexaen-1-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)N1CCCC1 |
| InChI | InChI=1S/C26H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-26(28)27-24-21-22-25-27/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-25H2,1H3/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | JUMJHELVPBEFME-KUBAVDMBSA-N |
| XLogP | 7.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|