About 1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate
1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate (PubChem CID 91705661) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate.
Molecular Properties
| Compound Name | 1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate |
| PubChem CID | 91705661 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate |
| SMILES | C=CC(C)OC(=O)CCCC(=O)OC(C)C(C)C |
| InChI | InChI=1S/C14H24O4/c1-6-11(4)17-13(15)8-7-9-14(16)18-12(5)10(2)3/h6,10-12H,1,7-9H2,2-5H3 |
| InChIKey | BXEPMNXRQIVLRR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate?
The IUPAC name of 1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate (CID 91705661) is 1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate.
What is the SMILES notation for 1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate?
The canonical SMILES for 1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate is C=CC(C)OC(=O)CCCC(=O)OC(C)C(C)C.
What is the InChIKey of 1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate?
The InChIKey is BXEPMNXRQIVLRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O4/c1-6-11(4)17-13(15)8-7-9-14(16)18-12(5)10(2)3/h6,10-12H,1,7-9H2,2-5H3.
What are the key properties of 1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate?
1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate has a molecular weight of 256.34 g/mol, XLogP of 2.86, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-but-3-en-2-yl 5-O-(3-methylbutan-2-yl) pentanedioate is sourced from PubChem (CID 91705661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).