About (5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium
(5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium (PubChem CID 9170648) has the molecular formula C6H12N3OS+
and a molecular weight of 174.25 g/mol. Its IUPAC name is (5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium.
Molecular Properties
| Compound Name | (5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium |
| PubChem CID | 9170648 |
| Molecular Formula | C6H12N3OS+ |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium |
| SMILES | CC(C)Sc1nnc(C[NH3+])o1 |
| InChI | InChI=1S/C6H11N3OS/c1-4(2)11-6-9-8-5(3-7)10-6/h4H,3,7H2,1-2H3/p+1 |
| InChIKey | XJIRLOKWNAIORQ-UHFFFAOYSA-O |
| XLogP | 0.31 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium?
The IUPAC name of (5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium (CID 9170648) is (5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium.
What is the SMILES notation for (5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium?
The canonical SMILES for (5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium is CC(C)Sc1nnc(C[NH3+])o1.
What is the InChIKey of (5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium?
The InChIKey is XJIRLOKWNAIORQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H11N3OS/c1-4(2)11-6-9-8-5(3-7)10-6/h4H,3,7H2,1-2H3/p+1.
What are the key properties of (5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium?
(5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium has a molecular weight of 174.25 g/mol, XLogP of 0.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-propan-2-ylsulfanyl-1,3,4-oxadiazol-2-yl)methylazanium is sourced from PubChem (CID 9170648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).