About bis(3,7-dimethyloctyl) pentanedioate
bis(3,7-dimethyloctyl) pentanedioate (PubChem CID 91706570) has the molecular formula C25H48O4
and a molecular weight of 412.66 g/mol. Its IUPAC name is bis(3,7-dimethyloctyl) pentanedioate.
Molecular Properties
| Compound Name | bis(3,7-dimethyloctyl) pentanedioate |
| PubChem CID | 91706570 |
| Molecular Formula | C25H48O4 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.36 |
| IUPAC Name | bis(3,7-dimethyloctyl) pentanedioate |
| SMILES | CC(C)CCCC(C)CCOC(=O)CCCC(=O)OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C25H48O4/c1-20(2)10-7-12-22(5)16-18-28-24(26)14-9-15-25(27)29-19-17-23(6)13-8-11-21(3)4/h20-23H,7-19H2,1-6H3 |
| InChIKey | NUXPEKJWRCBJBZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(3,7-dimethyloctyl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,7-dimethyloctyl) pentanedioate?
The IUPAC name of bis(3,7-dimethyloctyl) pentanedioate (CID 91706570) is bis(3,7-dimethyloctyl) pentanedioate.
What is the SMILES notation for bis(3,7-dimethyloctyl) pentanedioate?
The canonical SMILES for bis(3,7-dimethyloctyl) pentanedioate is CC(C)CCCC(C)CCOC(=O)CCCC(=O)OCCC(C)CCCC(C)C.
What is the InChIKey of bis(3,7-dimethyloctyl) pentanedioate?
The InChIKey is NUXPEKJWRCBJBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H48O4/c1-20(2)10-7-12-22(5)16-18-28-24(26)14-9-15-25(27)29-19-17-23(6)13-8-11-21(3)4/h20-23H,7-19H2,1-6H3.
What are the key properties of bis(3,7-dimethyloctyl) pentanedioate?
bis(3,7-dimethyloctyl) pentanedioate has a molecular weight of 412.66 g/mol, XLogP of 6.95, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,7-dimethyloctyl) pentanedioate is sourced from PubChem (CID 91706570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).