C16H30O4 — CID 91706791
5-O-(2,2-dimethylpropyl) 1-O-(4-methylpentyl) pentanedioate (PubChem CID 91706791) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is 5-O-(2,2-dimethylpropyl) 1-O-(4-methylpentyl) pentanedioate.
| Compound Name | 5-O-(2,2-dimethylpropyl) 1-O-(4-methylpentyl) pentanedioate |
|---|---|
| PubChem CID | 91706791 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 5-O-(2,2-dimethylpropyl) 1-O-(4-methylpentyl) pentanedioate |
| SMILES | CC(C)CCCOC(=O)CCCC(=O)OCC(C)(C)C |
| InChI | InChI=1S/C16H30O4/c1-13(2)8-7-11-19-14(17)9-6-10-15(18)20-12-16(3,4)5/h13H,6-12H2,1-5H3 |
| InChIKey | DPZIMINTVOHKMA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|