About bis(3-methylpentyl) pentanedioate
bis(3-methylpentyl) pentanedioate (PubChem CID 91706840) has the molecular formula C17H32O4
and a molecular weight of 300.44 g/mol. Its IUPAC name is bis(3-methylpentyl) pentanedioate.
Molecular Properties
| Compound Name | bis(3-methylpentyl) pentanedioate |
| PubChem CID | 91706840 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | bis(3-methylpentyl) pentanedioate |
| SMILES | CCC(C)CCOC(=O)CCCC(=O)OCCC(C)CC |
| InChI | InChI=1S/C17H32O4/c1-5-14(3)10-12-20-16(18)8-7-9-17(19)21-13-11-15(4)6-2/h14-15H,5-13H2,1-4H3 |
| InChIKey | NSXAMARMSXMDBI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(3-methylpentyl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-methylpentyl) pentanedioate?
The IUPAC name of bis(3-methylpentyl) pentanedioate (CID 91706840) is bis(3-methylpentyl) pentanedioate.
What is the SMILES notation for bis(3-methylpentyl) pentanedioate?
The canonical SMILES for bis(3-methylpentyl) pentanedioate is CCC(C)CCOC(=O)CCCC(=O)OCCC(C)CC.
What is the InChIKey of bis(3-methylpentyl) pentanedioate?
The InChIKey is NSXAMARMSXMDBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O4/c1-5-14(3)10-12-20-16(18)8-7-9-17(19)21-13-11-15(4)6-2/h14-15H,5-13H2,1-4H3.
What are the key properties of bis(3-methylpentyl) pentanedioate?
bis(3-methylpentyl) pentanedioate has a molecular weight of 300.44 g/mol, XLogP of 4.12, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methylpentyl) pentanedioate is sourced from PubChem (CID 91706840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).