C25H48O4 — CID 91707351
1-O-decyl 3-O-octyl 2,2-diethylpropanedioate (PubChem CID 91707351) has the molecular formula C25H48O4 and a molecular weight of 412.66 g/mol. Its IUPAC name is 1-O-decyl 3-O-octyl 2,2-diethylpropanedioate.
| Compound Name | 1-O-decyl 3-O-octyl 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91707351 |
| Molecular Formula | C25H48O4 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.36 |
| IUPAC Name | 1-O-decyl 3-O-octyl 2,2-diethylpropanedioate |
| SMILES | CCCCCCCCCCOC(=O)C(CC)(CC)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C25H48O4/c1-5-9-11-13-15-16-18-20-22-29-24(27)25(7-3,8-4)23(26)28-21-19-17-14-12-10-6-2/h5-22H2,1-4H3 |
| InChIKey | WCJHTKGVVNXBJW-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|