C14H18NO4- — CID 9170941
2-[[2-(2-tert-butylphenoxy)acetyl]amino]acetate (PubChem CID 9170941) has the molecular formula C14H18NO4- and a molecular weight of 264.30 g/mol. Its IUPAC name is 2-[[2-(2-tert-butylphenoxy)acetyl]amino]acetate.
| Compound Name | 2-[[2-(2-tert-butylphenoxy)acetyl]amino]acetate |
|---|---|
| PubChem CID | 9170941 |
| Molecular Formula | C14H18NO4- |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-[[2-(2-tert-butylphenoxy)acetyl]amino]acetate |
| SMILES | CC(C)(C)c1ccccc1OCC(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C14H19NO4/c1-14(2,3)10-6-4-5-7-11(10)19-9-12(16)15-8-13(17)18/h4-7H,8-9H2,1-3H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | YPDKOOMHZXVEBU-UHFFFAOYSA-M |
| XLogP | 0.23 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |