About octyl 2-[ethoxycarbonyl(methyl)amino]acetate
octyl 2-[ethoxycarbonyl(methyl)amino]acetate (PubChem CID 91709596) has the molecular formula C14H27NO4
and a molecular weight of 273.37 g/mol. Its IUPAC name is octyl 2-[ethoxycarbonyl(methyl)amino]acetate.
Molecular Properties
| Compound Name | octyl 2-[ethoxycarbonyl(methyl)amino]acetate |
| PubChem CID | 91709596 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | octyl 2-[ethoxycarbonyl(methyl)amino]acetate |
| SMILES | CCCCCCCCOC(=O)CN(C)C(=O)OCC |
| InChI | InChI=1S/C14H27NO4/c1-4-6-7-8-9-10-11-19-13(16)12-15(3)14(17)18-5-2/h4-12H2,1-3H3 |
| InChIKey | ZPTBOBQJZOEAKX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octyl 2-[ethoxycarbonyl(methyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl 2-[ethoxycarbonyl(methyl)amino]acetate?
The IUPAC name of octyl 2-[ethoxycarbonyl(methyl)amino]acetate (CID 91709596) is octyl 2-[ethoxycarbonyl(methyl)amino]acetate.
What is the SMILES notation for octyl 2-[ethoxycarbonyl(methyl)amino]acetate?
The canonical SMILES for octyl 2-[ethoxycarbonyl(methyl)amino]acetate is CCCCCCCCOC(=O)CN(C)C(=O)OCC.
What is the InChIKey of octyl 2-[ethoxycarbonyl(methyl)amino]acetate?
The InChIKey is ZPTBOBQJZOEAKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO4/c1-4-6-7-8-9-10-11-19-13(16)12-15(3)14(17)18-5-2/h4-12H2,1-3H3.
What are the key properties of octyl 2-[ethoxycarbonyl(methyl)amino]acetate?
octyl 2-[ethoxycarbonyl(methyl)amino]acetate has a molecular weight of 273.37 g/mol, XLogP of 2.98, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for octyl 2-[ethoxycarbonyl(methyl)amino]acetate is sourced from PubChem (CID 91709596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).