C12H23N2OP — CID 91709642
(1S,2S)-7-[(2S)-butan-2-yl]-6,8-diaza-7λ5-phosphatricyclo[6.3.0.02,6]undecane 7-oxide (PubChem CID 91709642) has the molecular formula C12H23N2OP and a molecular weight of 242.30 g/mol. Its IUPAC name is (1S,2S)-7-[(2S)-butan-2-yl]-6,8-diaza-7λ5-phosphatricyclo[6.3.0.02,6]undecane 7-oxide.
| Compound Name | (1S,2S)-7-[(2S)-butan-2-yl]-6,8-diaza-7λ5-phosphatricyclo[6.3.0.02,6]undecane 7-oxide |
|---|---|
| PubChem CID | 91709642 |
| Molecular Formula | C12H23N2OP |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (1S,2S)-7-[(2S)-butan-2-yl]-6,8-diaza-7λ5-phosphatricyclo[6.3.0.02,6]undecane 7-oxide |
| SMILES | CC[C@H](C)P1(=O)N2CCC[C@H]2[C@@H]2CCCN21 |
| InChI | InChI=1S/C12H23N2OP/c1-3-10(2)16(15)13-8-4-6-11(13)12-7-5-9-14(12)16/h10-12H,3-9H2,1-2H3/t10-,11-,12-/m0/s1 |
| InChIKey | AQRRXKTYVWZBIO-SRVKXCTJSA-N |
| XLogP | 2.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|