About 6,7-difluoroquinoxaline
6,7-difluoroquinoxaline (PubChem CID 917097) has the molecular formula C8H4F2N2
and a molecular weight of 166.13 g/mol. Its IUPAC name is 6,7-difluoroquinoxaline.
Molecular Properties
| Compound Name | 6,7-difluoroquinoxaline |
| PubChem CID | 917097 |
| Molecular Formula | C8H4F2N2 |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 6,7-difluoroquinoxaline |
| SMILES | Fc1cc2nccnc2cc1F |
| InChI | InChI=1S/C8H4F2N2/c9-5-3-7-8(4-6(5)10)12-2-1-11-7/h1-4H |
| InChIKey | XYNRHHBFPGAPHG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-difluoroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-difluoroquinoxaline?
The IUPAC name of 6,7-difluoroquinoxaline (CID 917097) is 6,7-difluoroquinoxaline.
What is the SMILES notation for 6,7-difluoroquinoxaline?
The canonical SMILES for 6,7-difluoroquinoxaline is Fc1cc2nccnc2cc1F.
What is the InChIKey of 6,7-difluoroquinoxaline?
The InChIKey is XYNRHHBFPGAPHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F2N2/c9-5-3-7-8(4-6(5)10)12-2-1-11-7/h1-4H.
What are the key properties of 6,7-difluoroquinoxaline?
6,7-difluoroquinoxaline has a molecular weight of 166.13 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-difluoroquinoxaline is sourced from PubChem (CID 917097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).