About 5-(2,4-dinitrophenoxy)-1-phenyltetrazole
5-(2,4-dinitrophenoxy)-1-phenyltetrazole (PubChem CID 91710345) has the molecular formula C13H8N6O5
and a molecular weight of 328.24 g/mol. Its IUPAC name is 5-(2,4-dinitrophenoxy)-1-phenyltetrazole.
Molecular Properties
| Compound Name | 5-(2,4-dinitrophenoxy)-1-phenyltetrazole |
| PubChem CID | 91710345 |
| Molecular Formula | C13H8N6O5 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 5-(2,4-dinitrophenoxy)-1-phenyltetrazole |
| SMILES | O=[N+]([O-])c1ccc(Oc2nnnn2-c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H8N6O5/c20-18(21)10-6-7-12(11(8-10)19(22)23)24-13-14-15-16-17(13)9-4-2-1-3-5-9/h1-8H |
| InChIKey | FJMSPTWVWQJEIR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 139.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,4-dinitrophenoxy)-1-phenyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dinitrophenoxy)-1-phenyltetrazole?
The IUPAC name of 5-(2,4-dinitrophenoxy)-1-phenyltetrazole (CID 91710345) is 5-(2,4-dinitrophenoxy)-1-phenyltetrazole.
What is the SMILES notation for 5-(2,4-dinitrophenoxy)-1-phenyltetrazole?
The canonical SMILES for 5-(2,4-dinitrophenoxy)-1-phenyltetrazole is O=[N+]([O-])c1ccc(Oc2nnnn2-c2ccccc2)c([N+](=O)[O-])c1.
What is the InChIKey of 5-(2,4-dinitrophenoxy)-1-phenyltetrazole?
The InChIKey is FJMSPTWVWQJEIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N6O5/c20-18(21)10-6-7-12(11(8-10)19(22)23)24-13-14-15-16-17(13)9-4-2-1-3-5-9/h1-8H.
What are the key properties of 5-(2,4-dinitrophenoxy)-1-phenyltetrazole?
5-(2,4-dinitrophenoxy)-1-phenyltetrazole has a molecular weight of 328.24 g/mol, XLogP of 2.27, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dinitrophenoxy)-1-phenyltetrazole is sourced from PubChem (CID 91710345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).