C10H20OS2 — CID 91710611
(3S,4S)-4-(1,3-dithian-2-yl)-3-methylpentan-1-ol (PubChem CID 91710611) has the molecular formula C10H20OS2 and a molecular weight of 220.40 g/mol. Its IUPAC name is (3S,4S)-4-(1,3-dithian-2-yl)-3-methylpentan-1-ol.
| Compound Name | (3S,4S)-4-(1,3-dithian-2-yl)-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 91710611 |
| Molecular Formula | C10H20OS2 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | (3S,4S)-4-(1,3-dithian-2-yl)-3-methylpentan-1-ol |
| SMILES | C[C@H](C1SCCCS1)[C@@H](C)CCO |
| InChI | InChI=1S/C10H20OS2/c1-8(4-5-11)9(2)10-12-6-3-7-13-10/h8-11H,3-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | UXPQPNAWNHBYEF-IUCAKERBSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |