C11H4F10O3 — CID 91710743
2-(2,3,4,5,6-pentafluorophenoxy)ethyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91710743) has the molecular formula C11H4F10O3 and a molecular weight of 374.13 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenoxy)ethyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenoxy)ethyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91710743 |
| Molecular Formula | C11H4F10O3 |
| Molecular Weight | 374.13 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenoxy)ethyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(OCCOc1c(F)c(F)c(F)c(F)c1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H4F10O3/c12-3-4(13)6(15)8(7(16)5(3)14)23-1-2-24-9(22)10(17,18)11(19,20)21/h1-2H2 |
| InChIKey | MXYICOZLRXPIIQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.13 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|