C18H24FNO3 — CID 91711967
4-methylpentyl 1-(4-fluorobenzoyl)pyrrolidine-2-carboxylate (PubChem CID 91711967) has the molecular formula C18H24FNO3 and a molecular weight of 321.39 g/mol. Its IUPAC name is 4-methylpentyl 1-(4-fluorobenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | 4-methylpentyl 1-(4-fluorobenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91711967 |
| Molecular Formula | C18H24FNO3 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-methylpentyl 1-(4-fluorobenzoyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)CCCOC(=O)C1CCCN1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FNO3/c1-13(2)5-4-12-23-18(22)16-6-3-11-20(16)17(21)14-7-9-15(19)10-8-14/h7-10,13,16H,3-6,11-12H2,1-2H3 |
| InChIKey | ZMALDJAEXXKPCC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|