C19H26F8O4 — CID 91712076
1-O-[(Z)-non-3-enyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate (PubChem CID 91712076) has the molecular formula C19H26F8O4 and a molecular weight of 470.40 g/mol. Its IUPAC name is 1-O-[(Z)-non-3-enyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate.
| Compound Name | 1-O-[(Z)-non-3-enyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
|---|---|
| PubChem CID | 91712076 |
| Molecular Formula | C19H26F8O4 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 1-O-[(Z)-non-3-enyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
| SMILES | CCCCC/C=C\CCOC(=O)CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C19H26F8O4/c1-2-3-4-5-6-7-8-12-30-14(28)10-9-11-15(29)31-13-17(22,23)19(26,27)18(24,25)16(20)21/h6-7,16H,2-5,8-13H2,1H3/b7-6- |
| InChIKey | YZJFJZWYGISADG-SREVYHEPSA-N |
| XLogP | 5.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|