C7H5F8NO3 — CID 91712743
2,2,3,3,3-pentafluoropropyl 2-[(2,2,2-trifluoroacetyl)amino]acetate (PubChem CID 91712743) has the molecular formula C7H5F8NO3 and a molecular weight of 303.11 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 2-[(2,2,2-trifluoroacetyl)amino]acetate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 2-[(2,2,2-trifluoroacetyl)amino]acetate |
|---|---|
| PubChem CID | 91712743 |
| Molecular Formula | C7H5F8NO3 |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-[(2,2,2-trifluoroacetyl)amino]acetate |
| SMILES | O=C(CNC(=O)C(F)(F)F)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F8NO3/c8-5(9,7(13,14)15)2-19-3(17)1-16-4(18)6(10,11)12/h1-2H2,(H,16,18) |
| InChIKey | CFGMCEHZRLPVKE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|