About 6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate
6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate (PubChem CID 91713843) has the molecular formula C16H30O4
and a molecular weight of 286.41 g/mol. Its IUPAC name is 6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate.
Molecular Properties
| Compound Name | 6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate |
| PubChem CID | 91713843 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate |
| SMILES | CC(C)COC(=O)CCCCC(=O)OC(C)CC(C)C |
| InChI | InChI=1S/C16H30O4/c1-12(2)10-14(5)20-16(18)9-7-6-8-15(17)19-11-13(3)4/h12-14H,6-11H2,1-5H3 |
| InChIKey | GMVPLWJHPXIVGS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate?
The IUPAC name of 6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate (CID 91713843) is 6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate.
What is the SMILES notation for 6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate?
The canonical SMILES for 6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate is CC(C)COC(=O)CCCCC(=O)OC(C)CC(C)C.
What is the InChIKey of 6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate?
The InChIKey is GMVPLWJHPXIVGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O4/c1-12(2)10-14(5)20-16(18)9-7-6-8-15(17)19-11-13(3)4/h12-14H,6-11H2,1-5H3.
What are the key properties of 6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate?
6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate has a molecular weight of 286.41 g/mol, XLogP of 3.72, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-O-(4-methylpentan-2-yl) 1-O-(2-methylpropyl) hexanedioate is sourced from PubChem (CID 91713843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).