About 6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate
6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate (PubChem CID 91713927) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is 6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate.
Molecular Properties
| Compound Name | 6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate |
| PubChem CID | 91713927 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate |
| SMILES | C=CCC(C)OC(=O)CCCCC(=O)OCCCCC |
| InChI | InChI=1S/C16H28O4/c1-4-6-9-13-19-15(17)11-7-8-12-16(18)20-14(3)10-5-2/h5,14H,2,4,6-13H2,1,3H3 |
| InChIKey | HMHVUQQWRHWDMU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate?
The IUPAC name of 6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate (CID 91713927) is 6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate.
What is the SMILES notation for 6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate?
The canonical SMILES for 6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate is C=CCC(C)OC(=O)CCCCC(=O)OCCCCC.
What is the InChIKey of 6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate?
The InChIKey is HMHVUQQWRHWDMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4/c1-4-6-9-13-19-15(17)11-7-8-12-16(18)20-14(3)10-5-2/h5,14H,2,4,6-13H2,1,3H3.
What are the key properties of 6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate?
6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate has a molecular weight of 284.40 g/mol, XLogP of 3.79, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-O-pent-4-en-2-yl 1-O-pentyl hexanedioate is sourced from PubChem (CID 91713927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).