C12H17F5N2O4 — CID 91714248
propyl 3-[3-(2,2,3,3,3-pentafluoropropanoylamino)propanoylamino]propanoate (PubChem CID 91714248) has the molecular formula C12H17F5N2O4 and a molecular weight of 348.27 g/mol. Its IUPAC name is propyl 3-[3-(2,2,3,3,3-pentafluoropropanoylamino)propanoylamino]propanoate.
| Compound Name | propyl 3-[3-(2,2,3,3,3-pentafluoropropanoylamino)propanoylamino]propanoate |
|---|---|
| PubChem CID | 91714248 |
| Molecular Formula | C12H17F5N2O4 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | propyl 3-[3-(2,2,3,3,3-pentafluoropropanoylamino)propanoylamino]propanoate |
| SMILES | CCCOC(=O)CCNC(=O)CCNC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H17F5N2O4/c1-2-7-23-9(21)4-6-18-8(20)3-5-19-10(22)11(13,14)12(15,16)17/h2-7H2,1H3,(H,18,20)(H,19,22) |
| InChIKey | ILNREXMACZJRAF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|