C23H37NO3 — CID 91714384
17-[(E)-N-ethoxy-C-methylcarbonimidoyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 91714384) has the molecular formula C23H37NO3 and a molecular weight of 375.55 g/mol. Its IUPAC name is 17-[(E)-N-ethoxy-C-methylcarbonimidoyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | 17-[(E)-N-ethoxy-C-methylcarbonimidoyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 91714384 |
| Molecular Formula | C23H37NO3 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.28 |
| IUPAC Name | 17-[(E)-N-ethoxy-C-methylcarbonimidoyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CCO/N=C(\C)C1(O)CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C23H37NO3/c1-5-27-24-15(2)23(26)13-10-20-18-7-6-16-14-17(25)8-11-21(16,3)19(18)9-12-22(20,23)4/h6,17-20,25-26H,5,7-14H2,1-4H3/b24-15+ |
| InChIKey | PSCDFPMOIHEZTK-BUVRLJJBSA-N |
| XLogP | 4.45 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|