C20H24F8O4 — CID 91714838
5-O-(2-adamantyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate (PubChem CID 91714838) has the molecular formula C20H24F8O4 and a molecular weight of 480.39 g/mol. Its IUPAC name is 5-O-(2-adamantyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate.
| Compound Name | 5-O-(2-adamantyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
|---|---|
| PubChem CID | 91714838 |
| Molecular Formula | C20H24F8O4 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 5-O-(2-adamantyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
| SMILES | O=C(CCCC(=O)OC1C2CC3CC(C2)CC1C3)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C20H24F8O4/c21-17(22)19(25,26)20(27,28)18(23,24)9-31-14(29)2-1-3-15(30)32-16-12-5-10-4-11(7-12)8-13(16)6-10/h10-13,16-17H,1-9H2 |
| InChIKey | ZUEBKGIVWAWCQD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|