About (3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium
(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium (PubChem CID 9171493) has the molecular formula C18H19ClN3O3S+
and a molecular weight of 392.89 g/mol. Its IUPAC name is (3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium.
Molecular Properties
| Compound Name | (3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium |
| PubChem CID | 9171493 |
| Molecular Formula | C18H19ClN3O3S+ |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium |
| SMILES | CC[NH+](Cc1ccc(Cl)s1)CN1C(=O)C(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H18ClN3O3S/c1-2-20(11-14-8-9-15(19)26-14)12-22-17(24)16(23)21(18(22)25)10-13-6-4-3-5-7-13/h3-9H,2,10-12H2,1H3/p+1 |
| InChIKey | MUVJCXZKNKMGRG-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze (3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium?
The IUPAC name of (3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium (CID 9171493) is (3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium.
What is the SMILES notation for (3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium?
The canonical SMILES for (3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium is CC[NH+](Cc1ccc(Cl)s1)CN1C(=O)C(=O)N(Cc2ccccc2)C1=O.
What is the InChIKey of (3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium?
The InChIKey is MUVJCXZKNKMGRG-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H18ClN3O3S/c1-2-20(11-14-8-9-15(19)26-14)12-22-17(24)16(23)21(18(22)25)10-13-6-4-3-5-7-13/h3-9H,2,10-12H2,1H3/p+1.
What are the key properties of (3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium?
(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium has a molecular weight of 392.89 g/mol, XLogP of 1.75, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzyl-2,4,5-trioxoimidazolidin-1-yl)methyl-[(5-chlorothiophen-2-yl)methyl]-ethylazanium is sourced from PubChem (CID 9171493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).