C18H16F8O4 — CID 91715033
1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-(1-phenylpropyl) (E)-but-2-enedioate (PubChem CID 91715033) has the molecular formula C18H16F8O4 and a molecular weight of 448.31 g/mol. Its IUPAC name is 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-(1-phenylpropyl) (E)-but-2-enedioate.
| Compound Name | 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-(1-phenylpropyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91715033 |
| Molecular Formula | C18H16F8O4 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-(1-phenylpropyl) (E)-but-2-enedioate |
| SMILES | CCC(OC(=O)/C=C/C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H16F8O4/c1-2-12(11-6-4-3-5-7-11)30-14(28)9-8-13(27)29-10-16(21,22)18(25,26)17(23,24)15(19)20/h3-9,12,15H,2,10H2,1H3/b9-8+ |
| InChIKey | VDWQZSMOHVNPMM-CMDGGOBGSA-N |
| XLogP | 4.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|