C14H24 — CID 91715050
(1R,2R,5R,7E)-7-ethylidene-1,2,8,8-tetramethylbicyclo[3.2.1]octane (PubChem CID 91715050) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is (1R,2R,5R,7E)-7-ethylidene-1,2,8,8-tetramethylbicyclo[3.2.1]octane.
| Compound Name | (1R,2R,5R,7E)-7-ethylidene-1,2,8,8-tetramethylbicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 91715050 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (1R,2R,5R,7E)-7-ethylidene-1,2,8,8-tetramethylbicyclo[3.2.1]octane |
| SMILES | C/C=C1\C[C@H]2CC[C@@H](C)[C@]1(C)C2(C)C |
| InChI | InChI=1S/C14H24/c1-6-11-9-12-8-7-10(2)14(11,5)13(12,3)4/h6,10,12H,7-9H2,1-5H3/b11-6+/t10-,12-,14+/m1/s1 |
| InChIKey | FMOZOFOCONBPNY-RAYWUTBOSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|