C20H28F4O4 — CID 91715245
1-O-[2-(1-adamantyl)ethyl] 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate (PubChem CID 91715245) has the molecular formula C20H28F4O4 and a molecular weight of 408.43 g/mol. Its IUPAC name is 1-O-[2-(1-adamantyl)ethyl] 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate.
| Compound Name | 1-O-[2-(1-adamantyl)ethyl] 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
|---|---|
| PubChem CID | 91715245 |
| Molecular Formula | C20H28F4O4 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 1-O-[2-(1-adamantyl)ethyl] 5-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
| SMILES | O=C(CCCC(=O)OCC(F)(F)C(F)F)OCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H28F4O4/c21-18(22)20(23,24)12-28-17(26)3-1-2-16(25)27-5-4-19-9-13-6-14(10-19)8-15(7-13)11-19/h13-15,18H,1-12H2 |
| InChIKey | UAZBIVUSIGHUFA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|