C22H28F8O4 — CID 91715246
1-O-[2-(1-adamantyl)ethyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate (PubChem CID 91715246) has the molecular formula C22H28F8O4 and a molecular weight of 508.45 g/mol. Its IUPAC name is 1-O-[2-(1-adamantyl)ethyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate.
| Compound Name | 1-O-[2-(1-adamantyl)ethyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
|---|---|
| PubChem CID | 91715246 |
| Molecular Formula | C22H28F8O4 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 1-O-[2-(1-adamantyl)ethyl] 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
| SMILES | O=C(CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)OCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H28F8O4/c23-18(24)21(27,28)22(29,30)20(25,26)12-34-17(32)3-1-2-16(31)33-5-4-19-9-13-6-14(10-19)8-15(7-13)11-19/h13-15,18H,1-12H2 |
| InChIKey | PSBIUOQDAZVVBN-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|