C11H6F7NO4 — CID 91715494
(3-nitrophenyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91715494) has the molecular formula C11H6F7NO4 and a molecular weight of 349.16 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | (3-nitrophenyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91715494 |
| Molecular Formula | C11H6F7NO4 |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | (3-nitrophenyl)methyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(OCc1cccc([N+](=O)[O-])c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H6F7NO4/c12-9(13,10(14,15)11(16,17)18)8(20)23-5-6-2-1-3-7(4-6)19(21)22/h1-4H,5H2 |
| InChIKey | HWXCMQNJHLYUJP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|