About (5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one
(5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one (PubChem CID 91715666) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is (5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one.
Molecular Properties
| Compound Name | (5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one |
| PubChem CID | 91715666 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one |
| SMILES | CC1=CC(=O)C[C@@H](C)[C@]12CCCC2=C(C)C |
| InChI | InChI=1S/C15H22O/c1-10(2)14-6-5-7-15(14)11(3)8-13(16)9-12(15)4/h8,12H,5-7,9H2,1-4H3/t12-,15+/m1/s1 |
| InChIKey | FRFUTKHLLZXSEK-DOMZBBRYSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one?
The IUPAC name of (5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one (CID 91715666) is (5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one.
What is the SMILES notation for (5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one?
The canonical SMILES for (5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one is CC1=CC(=O)C[C@@H](C)[C@]12CCCC2=C(C)C.
What is the InChIKey of (5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one?
The InChIKey is FRFUTKHLLZXSEK-DOMZBBRYSA-N. The full InChI is InChI=1S/C15H22O/c1-10(2)14-6-5-7-15(14)11(3)8-13(16)9-12(15)4/h8,12H,5-7,9H2,1-4H3/t12-,15+/m1/s1.
What are the key properties of (5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one?
(5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one has a molecular weight of 218.34 g/mol, XLogP of 4.05, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,6R)-6,10-dimethyl-4-propan-2-ylidenespiro[4.5]dec-9-en-8-one is sourced from PubChem (CID 91715666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).