C11H4ClF7O2S — CID 91715696
S-(3-carbonochloridoylphenyl) 2,2,3,3,4,4,4-heptafluorobutanethioate (PubChem CID 91715696) has the molecular formula C11H4ClF7O2S and a molecular weight of 368.66 g/mol. Its IUPAC name is S-(3-carbonochloridoylphenyl) 2,2,3,3,4,4,4-heptafluorobutanethioate.
| Compound Name | S-(3-carbonochloridoylphenyl) 2,2,3,3,4,4,4-heptafluorobutanethioate |
|---|---|
| PubChem CID | 91715696 |
| Molecular Formula | C11H4ClF7O2S |
| Molecular Weight | 368.66 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | S-(3-carbonochloridoylphenyl) 2,2,3,3,4,4,4-heptafluorobutanethioate |
| SMILES | O=C(Cl)c1cccc(SC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H4ClF7O2S/c12-7(20)5-2-1-3-6(4-5)22-8(21)9(13,14)10(15,16)11(17,18)19/h1-4H |
| InChIKey | BPOKCLDWSBNTME-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|