C11H9F5OS — CID 91715727
S-(2,4-dimethylphenyl) 2,2,3,3,3-pentafluoropropanethioate (PubChem CID 91715727) has the molecular formula C11H9F5OS and a molecular weight of 284.25 g/mol. Its IUPAC name is S-(2,4-dimethylphenyl) 2,2,3,3,3-pentafluoropropanethioate.
| Compound Name | S-(2,4-dimethylphenyl) 2,2,3,3,3-pentafluoropropanethioate |
|---|---|
| PubChem CID | 91715727 |
| Molecular Formula | C11H9F5OS |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | S-(2,4-dimethylphenyl) 2,2,3,3,3-pentafluoropropanethioate |
| SMILES | Cc1ccc(SC(=O)C(F)(F)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C11H9F5OS/c1-6-3-4-8(7(2)5-6)18-9(17)10(12,13)11(14,15)16/h3-5H,1-2H3 |
| InChIKey | ZBKGMJHCMBAADS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|