C17H9F12NO7 — CID 91716732
[4-[2-[methyl-(2,2,2-trifluoroacetyl)amino]-1-(2,2,2-trifluoroacetyl)oxyethyl]-2-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate (PubChem CID 91716732) has the molecular formula C17H9F12NO7 and a molecular weight of 567.24 g/mol. Its IUPAC name is [4-[2-[methyl-(2,2,2-trifluoroacetyl)amino]-1-(2,2,2-trifluoroacetyl)oxyethyl]-2-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[2-[methyl-(2,2,2-trifluoroacetyl)amino]-1-(2,2,2-trifluoroacetyl)oxyethyl]-2-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91716732 |
| Molecular Formula | C17H9F12NO7 |
| Molecular Weight | 567.24 g/mol |
| Exact Mass | 567.02 |
| IUPAC Name | [4-[2-[methyl-(2,2,2-trifluoroacetyl)amino]-1-(2,2,2-trifluoroacetyl)oxyethyl]-2-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate |
| SMILES | CN(CC(OC(=O)C(F)(F)F)c1ccc(OC(=O)C(F)(F)F)c(OC(=O)C(F)(F)F)c1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C17H9F12NO7/c1-30(10(31)14(18,19)20)5-9(37-13(34)17(27,28)29)6-2-3-7(35-11(32)15(21,22)23)8(4-6)36-12(33)16(24,25)26/h2-4,9H,5H2,1H3 |
| InChIKey | NOEFXLYARFWKQU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|