C16H12F9NO6 — CID 91716862
[2-methoxy-4-[2-[methyl-(2,2,2-trifluoroacetyl)amino]-1-(2,2,2-trifluoroacetyl)oxyethyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 91716862) has the molecular formula C16H12F9NO6 and a molecular weight of 485.26 g/mol. Its IUPAC name is [2-methoxy-4-[2-[methyl-(2,2,2-trifluoroacetyl)amino]-1-(2,2,2-trifluoroacetyl)oxyethyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-methoxy-4-[2-[methyl-(2,2,2-trifluoroacetyl)amino]-1-(2,2,2-trifluoroacetyl)oxyethyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91716862 |
| Molecular Formula | C16H12F9NO6 |
| Molecular Weight | 485.26 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | [2-methoxy-4-[2-[methyl-(2,2,2-trifluoroacetyl)amino]-1-(2,2,2-trifluoroacetyl)oxyethyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | COc1cc(C(CN(C)C(=O)C(F)(F)F)OC(=O)C(F)(F)F)ccc1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H12F9NO6/c1-26(11(27)14(17,18)19)6-10(32-13(29)16(23,24)25)7-3-4-8(9(5-7)30-2)31-12(28)15(20,21)22/h3-5,10H,6H2,1-2H3 |
| InChIKey | AIKLVQAXEMSHQZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|