C18H10F2O5 — CID 91716966
[2-(2,6-difluorobenzoyl)oxyphenyl] furan-2-carboxylate (PubChem CID 91716966) has the molecular formula C18H10F2O5 and a molecular weight of 344.27 g/mol. Its IUPAC name is [2-(2,6-difluorobenzoyl)oxyphenyl] furan-2-carboxylate.
| Compound Name | [2-(2,6-difluorobenzoyl)oxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 91716966 |
| Molecular Formula | C18H10F2O5 |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | [2-(2,6-difluorobenzoyl)oxyphenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1ccccc1OC(=O)c1c(F)cccc1F)c1ccco1 |
| InChI | InChI=1S/C18H10F2O5/c19-11-5-3-6-12(20)16(11)18(22)25-14-8-2-1-7-13(14)24-17(21)15-9-4-10-23-15/h1-10H |
| InChIKey | JRKSYKFDPRJBPI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|