C21H18F8O4 — CID 91717352
1-O-(naphthalen-2-ylmethyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate (PubChem CID 91717352) has the molecular formula C21H18F8O4 and a molecular weight of 486.36 g/mol. Its IUPAC name is 1-O-(naphthalen-2-ylmethyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate.
| Compound Name | 1-O-(naphthalen-2-ylmethyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
|---|---|
| PubChem CID | 91717352 |
| Molecular Formula | C21H18F8O4 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 1-O-(naphthalen-2-ylmethyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
| SMILES | O=C(CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H18F8O4/c22-18(23)20(26,27)21(28,29)19(24,25)12-33-17(31)7-3-6-16(30)32-11-13-8-9-14-4-1-2-5-15(14)10-13/h1-2,4-5,8-10,18H,3,6-7,11-12H2 |
| InChIKey | WQRSPADQHSGMPZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|