C19H23F3O2Si — CID 91717510
butoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane (PubChem CID 91717510) has the molecular formula C19H23F3O2Si and a molecular weight of 368.47 g/mol. Its IUPAC name is butoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane.
| Compound Name | butoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane |
|---|---|
| PubChem CID | 91717510 |
| Molecular Formula | C19H23F3O2Si |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | butoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane |
| SMILES | CCCCO[Si](OC(C)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23F3O2Si/c1-3-4-15-23-25(17-11-7-5-8-12-17,18-13-9-6-10-14-18)24-16(2)19(20,21)22/h5-14,16H,3-4,15H2,1-2H3 |
| InChIKey | WNAJGEODCYFVAM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|