About hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate
hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate (PubChem CID 91717550) has the molecular formula C19H25F2NO3
and a molecular weight of 353.41 g/mol. Its IUPAC name is hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate |
| PubChem CID | 91717550 |
| Molecular Formula | C19H25F2NO3 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate |
| SMILES | CCCCCCOC(=O)C1CCN(C(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H25F2NO3/c1-2-3-4-5-12-25-19(24)14-8-10-22(11-9-14)18(23)15-6-7-16(20)17(21)13-15/h6-7,13-14H,2-5,8-12H2,1H3 |
| InChIKey | ALJUKUHOVQYIMU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate?
The IUPAC name of hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate (CID 91717550) is hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate.
What is the SMILES notation for hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate?
The canonical SMILES for hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate is CCCCCCOC(=O)C1CCN(C(=O)c2ccc(F)c(F)c2)CC1.
What is the InChIKey of hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate?
The InChIKey is ALJUKUHOVQYIMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25F2NO3/c1-2-3-4-5-12-25-19(24)14-8-10-22(11-9-14)18(23)15-6-7-16(20)17(21)13-15/h6-7,13-14H,2-5,8-12H2,1H3.
What are the key properties of hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate?
hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate has a molecular weight of 353.41 g/mol, XLogP of 3.94, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 1-(3,4-difluorobenzoyl)piperidine-4-carboxylate is sourced from PubChem (CID 91717550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).