C19H9F15O2 — CID 91717646
naphthalen-2-ylmethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate (PubChem CID 91717646) has the molecular formula C19H9F15O2 and a molecular weight of 554.25 g/mol. Its IUPAC name is naphthalen-2-ylmethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate.
| Compound Name | naphthalen-2-ylmethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
|---|---|
| PubChem CID | 91717646 |
| Molecular Formula | C19H9F15O2 |
| Molecular Weight | 554.25 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | naphthalen-2-ylmethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| SMILES | O=C(OCc1ccc2ccccc2c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H9F15O2/c20-13(21,12(35)36-8-9-5-6-10-3-1-2-4-11(10)7-9)14(22,23)15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)34/h1-7H,8H2 |
| InChIKey | KEGLMDXZOJBLEH-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.25 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|