About 2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one
2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one (PubChem CID 91717801) has the molecular formula C16H28N2O3
and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one |
| PubChem CID | 91717801 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one |
| SMILES | CCCCCCCCCCCCc1nc(O)c(O)c(=O)[nH]1 |
| InChI | InChI=1S/C16H28N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-15(20)14(19)16(21)18-13/h19H,2-12H2,1H3,(H2,17,18,20,21) |
| InChIKey | WBDAVQVFCURLIH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one?
The IUPAC name of 2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one (CID 91717801) is 2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one.
What is the SMILES notation for 2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one?
The canonical SMILES for 2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one is CCCCCCCCCCCCc1nc(O)c(O)c(=O)[nH]1.
What is the InChIKey of 2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one?
The InChIKey is WBDAVQVFCURLIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-15(20)14(19)16(21)18-13/h19H,2-12H2,1H3,(H2,17,18,20,21).
What are the key properties of 2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one?
2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one has a molecular weight of 296.41 g/mol, XLogP of 3.64, 11 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dodecyl-4,5-dihydroxy-1H-pyrimidin-6-one is sourced from PubChem (CID 91717801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).