C22H39N3O6 — CID 91717809
hexyl 2-[methyl-[2-[methyl-[2-[methyl(prop-2-enoxycarbonyl)amino]propanoyl]amino]propanoyl]amino]propanoate (PubChem CID 91717809) has the molecular formula C22H39N3O6 and a molecular weight of 441.57 g/mol. Its IUPAC name is hexyl 2-[methyl-[2-[methyl-[2-[methyl(prop-2-enoxycarbonyl)amino]propanoyl]amino]propanoyl]amino]propanoate.
| Compound Name | hexyl 2-[methyl-[2-[methyl-[2-[methyl(prop-2-enoxycarbonyl)amino]propanoyl]amino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 91717809 |
| Molecular Formula | C22H39N3O6 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | hexyl 2-[methyl-[2-[methyl-[2-[methyl(prop-2-enoxycarbonyl)amino]propanoyl]amino]propanoyl]amino]propanoate |
| SMILES | C=CCOC(=O)N(C)C(C)C(=O)N(C)C(C)C(=O)N(C)C(C)C(=O)OCCCCCC |
| InChI | InChI=1S/C22H39N3O6/c1-9-11-12-13-15-30-21(28)18(5)24(7)19(26)16(3)23(6)20(27)17(4)25(8)22(29)31-14-10-2/h10,16-18H,2,9,11-15H2,1,3-8H3 |
| InChIKey | DOLNWDCGAPYUBZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|