C9H21N5OSi2 — CID 91717865
2-N-trimethylsilyl-6-trimethylsilyloxy-1,3,5-triazine-2,4-diamine (PubChem CID 91717865) has the molecular formula C9H21N5OSi2 and a molecular weight of 271.47 g/mol. Its IUPAC name is 2-N-trimethylsilyl-6-trimethylsilyloxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-trimethylsilyl-6-trimethylsilyloxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 91717865 |
| Molecular Formula | C9H21N5OSi2 |
| Molecular Weight | 271.47 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-N-trimethylsilyl-6-trimethylsilyloxy-1,3,5-triazine-2,4-diamine |
| SMILES | C[Si](C)(C)Nc1nc(N)nc(O[Si](C)(C)C)n1 |
| InChI | InChI=1S/C9H21N5OSi2/c1-16(2,3)14-8-11-7(10)12-9(13-8)15-17(4,5)6/h1-6H3,(H3,10,11,12,13,14) |
| InChIKey | COKGMZCHEWFSOH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|