C21H14Cl2N4O2S — CID 91717870
N-[5-[(2,5-dichlorophenyl)diazenyl]quinolin-8-yl]benzenesulfonamide (PubChem CID 91717870) has the molecular formula C21H14Cl2N4O2S and a molecular weight of 457.34 g/mol. Its IUPAC name is N-[5-[(2,5-dichlorophenyl)diazenyl]quinolin-8-yl]benzenesulfonamide.
| Compound Name | N-[5-[(2,5-dichlorophenyl)diazenyl]quinolin-8-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 91717870 |
| Molecular Formula | C21H14Cl2N4O2S |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | N-[5-[(2,5-dichlorophenyl)diazenyl]quinolin-8-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(/N=N/c2cc(Cl)ccc2Cl)c2cccnc12)c1ccccc1 |
| InChI | InChI=1S/C21H14Cl2N4O2S/c22-14-8-9-17(23)20(13-14)26-25-18-10-11-19(21-16(18)7-4-12-24-21)27-30(28,29)15-5-2-1-3-6-15/h1-13,27H/b26-25+ |
| InChIKey | IZQPQKWKUYIWDO-OCEACIFDSA-N |
| XLogP | 6.76 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|