About diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane
diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane (PubChem CID 91718002) has the molecular formula C18H18F6O2Si
and a molecular weight of 408.41 g/mol. Its IUPAC name is diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane.
Molecular Properties
| Compound Name | diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane |
| PubChem CID | 91718002 |
| Molecular Formula | C18H18F6O2Si |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane |
| SMILES | CC(O[Si](OC(C)C(F)(F)F)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H18F6O2Si/c1-13(17(19,20)21)25-27(15-9-5-3-6-10-15,16-11-7-4-8-12-16)26-14(2)18(22,23)24/h3-14H,1-2H3 |
| InChIKey | XMXOIWHHNIOPCB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane?
The IUPAC name of diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane (CID 91718002) is diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane.
What is the SMILES notation for diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane?
The canonical SMILES for diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane is CC(O[Si](OC(C)C(F)(F)F)(c1ccccc1)c1ccccc1)C(F)(F)F.
What is the InChIKey of diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane?
The InChIKey is XMXOIWHHNIOPCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F6O2Si/c1-13(17(19,20)21)25-27(15-9-5-3-6-10-15,16-11-7-4-8-12-16)26-14(2)18(22,23)24/h3-14H,1-2H3.
What are the key properties of diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane?
diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane has a molecular weight of 408.41 g/mol, XLogP of 4.18, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-bis(1,1,1-trifluoropropan-2-yloxy)silane is sourced from PubChem (CID 91718002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).