About 5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate
5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate (PubChem CID 91718068) has the molecular formula C13H15ClO4
and a molecular weight of 270.71 g/mol. Its IUPAC name is 5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate.
Molecular Properties
| Compound Name | 5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate |
| PubChem CID | 91718068 |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate |
| SMILES | CCOC(=O)CCCC(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H15ClO4/c1-2-17-12(15)4-3-5-13(16)18-11-8-6-10(14)7-9-11/h6-9H,2-5H2,1H3 |
| InChIKey | FYKIEMRIEBPPDA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate?
The IUPAC name of 5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate (CID 91718068) is 5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate.
What is the SMILES notation for 5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate?
The canonical SMILES for 5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate is CCOC(=O)CCCC(=O)Oc1ccc(Cl)cc1.
What is the InChIKey of 5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate?
The InChIKey is FYKIEMRIEBPPDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClO4/c1-2-17-12(15)4-3-5-13(16)18-11-8-6-10(14)7-9-11/h6-9H,2-5H2,1H3.
What are the key properties of 5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate?
5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate has a molecular weight of 270.71 g/mol, XLogP of 2.98, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-(4-chlorophenyl) 1-O-ethyl pentanedioate is sourced from PubChem (CID 91718068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).