About 5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate
5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate (PubChem CID 91718135) has the molecular formula C14H16BrFO4
and a molecular weight of 347.18 g/mol. Its IUPAC name is 5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate.
Molecular Properties
| Compound Name | 5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate |
| PubChem CID | 91718135 |
| Molecular Formula | C14H16BrFO4 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate |
| SMILES | CCOC(=O)CCCC(=O)OCc1cc(F)ccc1Br |
| InChI | InChI=1S/C14H16BrFO4/c1-2-19-13(17)4-3-5-14(18)20-9-10-8-11(16)6-7-12(10)15/h6-8H,2-5,9H2,1H3 |
| InChIKey | PZHWRTHGTKHXSG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate?
The IUPAC name of 5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate (CID 91718135) is 5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate.
What is the SMILES notation for 5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate?
The canonical SMILES for 5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate is CCOC(=O)CCCC(=O)OCc1cc(F)ccc1Br.
What is the InChIKey of 5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate?
The InChIKey is PZHWRTHGTKHXSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrFO4/c1-2-19-13(17)4-3-5-14(18)20-9-10-8-11(16)6-7-12(10)15/h6-8H,2-5,9H2,1H3.
What are the key properties of 5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate?
5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate has a molecular weight of 347.18 g/mol, XLogP of 3.36, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-[(2-bromo-5-fluorophenyl)methyl] 1-O-ethyl pentanedioate is sourced from PubChem (CID 91718135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).